Bump

see https://github.com/black-sliver/pyevermizer/releases/tag/v0.40.0

LttPAdjuster.py

@@ -20,7 +20,7 @@ from urllib.parse import urlparse
 from urllib.request import urlopen
 
 from worlds.alttp.Rom import Sprite, LocalRom, apply_rom_settings, get_base_rom_bytes
-from Utils import output_path, local_path, open_file
+from Utils import output_path, local_path, open_file, get_cert_none_ssl_context, persistent_store
 
 
 class AdjusterWorld(object):
@@ -102,14 +102,15 @@ def main():
     parser.add_argument('--update_sprites', action='store_true', help='Update Sprite Database, then exit.')
     args = parser.parse_args()
     args.music = not args.disablemusic
-    if args.update_sprites:
-        run_sprite_update()
-        sys.exit()
     # set up logger
     loglevel = {'error': logging.ERROR, 'info': logging.INFO, 'warning': logging.WARNING, 'debug': logging.DEBUG}[
         args.loglevel]
     logging.basicConfig(format='%(message)s', level=loglevel)
 
+    if args.update_sprites:
+        run_sprite_update()
+        sys.exit()
+
     if not os.path.isfile(args.rom):
         adjustGUI()
     else:
@@ -118,7 +119,6 @@ def main():
             sys.exit(1)
 
         args, path = adjust(args=args)
-        from Utils import persistent_store
         if isinstance(args.sprite, Sprite):
             args.sprite = args.sprite.name
         persistent_store("adjuster", "last_settings_3", args)
@@ -224,7 +224,6 @@ def adjustGUI():
             messagebox.showerror(title="Error while adjusting Rom", message=str(e))
         else:
             messagebox.showinfo(title="Success", message=f"Rom patched successfully to {path}")
-            from Utils import persistent_store
             if isinstance(guiargs.sprite, Sprite):
                 guiargs.sprite = guiargs.sprite.name
             persistent_store("adjuster", "last_settings_3", guiargs)
@@ -241,12 +240,16 @@ def adjustGUI():
 def run_sprite_update():
     import threading
     done = threading.Event()
-    top = Tk()
+    try:
-    top.withdraw()
+        top = Tk()
-    BackgroundTaskProgress(top, update_sprites, "Updating Sprites", lambda succesful, resultmessage: done.set())
+    except:
+        task = BackgroundTaskProgressNullWindow(update_sprites, lambda successful, resultmessage: done.set())
+    else:
+        top.withdraw()
+        task = BackgroundTaskProgress(top, update_sprites, "Updating Sprites", lambda succesful, resultmessage: done.set())
     while not done.isSet():
-        top.update()
+        task.do_events()
-    print("Done updating sprites")
+    logging.info("Done updating sprites")
 
 
 def update_sprites(task, on_finish=None):
@@ -254,7 +257,7 @@ def update_sprites(task, on_finish=None):
     successful = True
     sprite_dir = local_path("data", "sprites", "alttpr")
     os.makedirs(sprite_dir, exist_ok=True)
-
+    ctx = get_cert_none_ssl_context()
     def finished():
         task.close_window()
         if on_finish:
@@ -262,7 +265,7 @@ def update_sprites(task, on_finish=None):
 
     try:
         task.update_status("Downloading alttpr sprites list")
-        with urlopen('https://alttpr.com/sprites') as response:
+        with urlopen('https://alttpr.com/sprites', context=ctx) as response:
             sprites_arr = json.loads(response.read().decode("utf-8"))
     except Exception as e:
         resultmessage = "Error getting list of alttpr sprites. Sprites not updated.\n\n%s: %s" % (type(e).__name__, e)
@@ -289,7 +292,7 @@ def update_sprites(task, on_finish=None):
 
     def dl(sprite_url, filename):
         target = os.path.join(sprite_dir, filename)
-        with urlopen(sprite_url) as response, open(target, 'wb') as out:
+        with urlopen(sprite_url, context=ctx) as response, open(target, 'wb') as out:
             shutil.copyfileobj(response, out)
 
     def rem(sprite):
@@ -400,12 +403,39 @@ class BackgroundTaskProgress(BackgroundTask):
     def update_status(self, text):
         self.queue_event(lambda: self.label_var.set(text))
 
+    def do_events(self):
+        self.parent.update()
+
     # only call this in an event callback
     def close_window(self):
         self.stop()
         self.window.destroy()
 
 
+class BackgroundTaskProgressNullWindow(BackgroundTask):
+    def __init__(self, code_to_run, *args):
+        super().__init__(None, code_to_run, *args)
+
+    def process_queue(self):
+        try:
+            while True:
+                if not self.running:
+                    return
+                event = self.queue.get_nowait()
+                event()
+        except queue.Empty:
+            pass
+
+    def do_events(self):
+        self.process_queue()
+
+    def update_status(self, text):
+        self.queue_event(lambda: logging.info(text))
+
+    def close_window(self):
+        self.stop()
+
+
 def get_rom_frame(parent=None):
     romFrame = Frame(parent)
     baseRomLabel = Label(romFrame, text='LttP Base Rom: ')

MinecraftClient.py

@@ -15,7 +15,7 @@ atexit.register(input, "Press enter to exit.")
 
 # 1 or more digits followed by m or g, then optional b
 max_heap_re = re.compile(r"^\d+[mMgG][bB]?$")
-forge_version = "1.17.1-37.0.109"
+forge_version = "1.17.1-37.1.1"
 
 
 def prompt_yes_no(prompt):
@@ -35,12 +35,10 @@ def prompt_yes_no(prompt):
 def find_ap_randomizer_jar(forge_dir):
     mods_dir = os.path.join(forge_dir, 'mods')
     if os.path.isdir(mods_dir):
-        ap_mod_re = re.compile(r"^aprandomizer-[\d\.]+\.jar$")
         for entry in os.scandir(mods_dir):
-            match = ap_mod_re.match(entry.name)
+            if entry.name.startswith("aprandomizer") and entry.name.endswith(".jar"):
-            if match:
+                logging.info(f"Found AP randomizer mod: {entry.name}")
-                logging.info(f"Found AP randomizer mod: {match.group()}")
+                return entry.name
-                return match.group()
         return None
     else:
         os.mkdir(mods_dir)

README.md

@@ -13,6 +13,7 @@ Currently, the following games are supported:
 * Timespinner
 * Super Metroid
 * Secret of Evermore
+* Final Fantasy
 
 For setup and instructions check out our [tutorials page](https://archipelago.gg/tutorial/).
 Downloads can be found at [Releases](https://github.com/ArchipelagoMW/Archipelago/releases), including compiled

SNIClient.py

@@ -1048,6 +1048,7 @@ async def game_watcher(ctx: Context):
                     ctx.location_name_getter(item.location), itemOutPtr, len(ctx.items_received)))
             await snes_flush_writes(ctx)
 
+
 async def run_game(romfile):
     auto_start = Utils.get_options()["lttp_options"].get("rom_start", True)
     if auto_start is True:

Utils.py

@@ -23,7 +23,7 @@ class Version(typing.NamedTuple):
     build: int
 
 
-__version__ = "0.2.1"
+__version__ = "0.2.2"
 version_tuple = tuplize_version(__version__)
 
 from yaml import load, dump, safe_load

WebHost.py

@@ -14,7 +14,7 @@ from WebHostLib import app as raw_app
 from waitress import serve
 
 from WebHostLib.models import db
-from WebHostLib.autolauncher import autohost
+from WebHostLib.autolauncher import autohost, autogen
 from WebHostLib.lttpsprites import update_sprites_lttp
 from WebHostLib.options import create as create_options_files
 
@@ -45,6 +45,8 @@ if __name__ == "__main__":
     create_options_files()
     if app.config["SELFLAUNCH"]:
         autohost(app.config)
+    if app.config["SELFGEN"]:
+        autogen(app.config)
     if app.config["SELFHOST"]:  # using WSGI, you just want to run get_app()
         if app.config["DEBUG"]:
             autohost(app.config)

WebHostLib/__init__.py

@@ -22,9 +22,10 @@ Pony(app)
 app.jinja_env.filters['any'] = any
 app.jinja_env.filters['all'] = all
 
-app.config["SELFHOST"] = True
+app.config["SELFHOST"] = True  # application process is in charge of running the websites
 app.config["GENERATORS"] = 8  # maximum concurrent world gens
-app.config["SELFLAUNCH"] = True
+app.config["SELFLAUNCH"] = True  # application process is in charge of launching Rooms.
+app.config["SELFGEN"] = True  # application process is in charge of scheduling Generations.
 app.config["DEBUG"] = False
 app.config["PORT"] = 80
 app.config['UPLOAD_FOLDER'] = UPLOAD_FOLDER
@@ -166,8 +167,9 @@ def host_room(room: UUID):
     if request.method == "POST":
         if room.owner == session["_id"]:
             cmd = request.form["cmd"]
-            Command(room=room, commandtext=cmd)
+            if cmd:
-            commit()
+                Command(room=room, commandtext=cmd)
+                commit()
 
     with db_session:
         room.last_activity = datetime.utcnow()  # will trigger a spinup, if it's not already running

WebHostLib/autolauncher.py

@@ -110,6 +110,26 @@ def autohost(config: dict):
     def keep_running():
         try:
             with Locker("autohost"):
+                while 1:
+                    time.sleep(0.1)
+                    with db_session:
+                        rooms = select(
+                            room for room in Room if
+                            room.last_activity >= datetime.utcnow() - timedelta(days=3))
+                        for room in rooms:
+                            launch_room(room, config)
+
+        except AlreadyRunningException:
+            logging.info("Autohost reports as already running, not starting another.")
+
+    import threading
+    threading.Thread(target=keep_running, name="AP_Autohost").start()
+
+
+def autogen(config: dict):
+    def keep_running():
+        try:
+            with Locker("autogen"):
 
                 with multiprocessing.Pool(config["GENERATORS"], initializer=init_db,
                                           initargs=(config["PONY"],)) as generator_pool:
@@ -129,22 +149,17 @@ def autohost(config: dict):
                         select(generation for generation in Generation if generation.state == STATE_ERROR).delete()
 
                     while 1:
-                        time.sleep(0.50)
+                        time.sleep(0.1)
                         with db_session:
-                            rooms = select(
-                                room for room in Room if
-                                room.last_activity >= datetime.utcnow() - timedelta(days=3))
-                            for room in rooms:
-                                launch_room(room, config)
                             to_start = select(
                                 generation for generation in Generation if generation.state == STATE_QUEUED)
                             for generation in to_start:
                                 launch_generator(generator_pool, generation)
         except AlreadyRunningException:
-            pass
+            logging.info("Autogen reports as already running, not starting another.")
 
     import threading
-    threading.Thread(target=keep_running).start()
+    threading.Thread(target=keep_running, name="AP_Autogen").start()
 
 
 multiworlds = {}

WebHostLib/lttpsprites.py

@@ -10,6 +10,7 @@ def update_sprites_lttp():
     from tkinter import Tk
     from LttPAdjuster import get_image_for_sprite
     from LttPAdjuster import BackgroundTaskProgress
+    from LttPAdjuster import BackgroundTaskProgressNullWindow
     from LttPAdjuster import update_sprites
 
     # Target directories
@@ -19,11 +20,15 @@ def update_sprites_lttp():
     os.makedirs(os.path.join(output_dir, "sprites"), exist_ok=True)
     # update sprites through gui.py's functions
     done = threading.Event()
-    top = Tk()
+    try:
-    top.withdraw()
+        top = Tk()
-    BackgroundTaskProgress(top, update_sprites, "Updating Sprites", lambda succesful, resultmessage: done.set())
+    except:
+        task = BackgroundTaskProgressNullWindow(update_sprites, lambda successful, resultmessage: done.set())
+    else:
+        top.withdraw()
+        task = BackgroundTaskProgress(top, update_sprites, "Updating Sprites", lambda succesful, resultmessage: done.set())
     while not done.isSet():
-        top.update()
+        task.do_events()
 
     spriteData = []
 

WebHostLib/static/assets/gameInfo/en_Final Fantasy.md

@@ -12,12 +12,9 @@ locations. So ,for example, Princess Sarah may have the CANOE instead of the LUT
 Pot or some armor. There are plenty of other things that can be randomized on our 
 [main randomizer site](https://finalfantasyrandomizer.com/)
 
-Some features are not currently supported by AP. A non-exhaustive list includes:
-- Shard Hunt
-- Deep Dungeon
-
 ## What Final Fantasy items can appear in other players' worlds?
-Currently, only progression items can appear in other players' worlds. Armor, Weapons and Consumable Items can not.
+All items can appear in other players worlds. This includes consumables, shards, weapons, armor and, of course,
+key items.
 
 ## What does another world's item look like in Final Fantasy
 All local and remote items appear the same. It will say that you received an item and then BOTH the client log and

WebHostLib/static/assets/gameInfo/en_Secret of Evermore.md

@@ -10,7 +10,7 @@ so the game is always able to be completed. However, because of the item shuffle
 areas before they would in the vanilla game. For example, the Windwalker (flying machine) is accessible as soon as any
 weapon is obtained.
 
-Additional help can be found in the [guide](https://github.com/black-sliver/evermizer/blob/feat-mw/guide.md).
+Additional help can be found in the [guide](https://github.com/black-sliver/evermizer/blob/master/guide.md).
 
 ## What items and locations get shuffled?
 All gourds/chests/pots, boss drops and alchemists are shuffled. Alchemy ingredients, sniff spot items, call bead spells

WebHostLib/static/assets/supermetroidTracker.js

@@ -0,0 +1,49 @@
+window.addEventListener('load', () => {
+  // Reload tracker every 15 seconds
+  const url = window.location;
+  setInterval(() => {
+    const ajax = new XMLHttpRequest();
+    ajax.onreadystatechange = () => {
+      if (ajax.readyState !== 4) { return; }
+
+      // Create a fake DOM using the returned HTML
+      const domParser = new DOMParser();
+      const fakeDOM = domParser.parseFromString(ajax.responseText, 'text/html');
+
+      // Update item tracker
+      document.getElementById('inventory-table').innerHTML = fakeDOM.getElementById('inventory-table').innerHTML;
+      // Update only counters in the location-table
+      let counters = document.getElementsByClassName('counter');
+      const fakeCounters = fakeDOM.getElementsByClassName('counter');
+      for (let i = 0; i < counters.length; i++) {
+        counters[i].innerHTML = fakeCounters[i].innerHTML;
+      }
+    };
+    ajax.open('GET', url);
+    ajax.send();
+  }, 15000)
+
+  // Collapsible advancement sections
+  const categories = document.getElementsByClassName("location-category");
+  for (let i = 0; i < categories.length; i++) {
+    let hide_id = categories[i].id.split('-')[0];
+    if (hide_id == 'Total') {
+      continue;
+    }
+    categories[i].addEventListener('click', function() {
+      // Toggle the advancement list
+      document.getElementById(hide_id).classList.toggle("hide");
+      // Change text of the header
+      const tab_header = document.getElementById(hide_id+'-header').children[0];
+      const orig_text = tab_header.innerHTML;
+      let new_text;
+      if (orig_text.includes("▼")) {
+        new_text = orig_text.replace("▼", "▲");
+      }
+      else {
+        new_text = orig_text.replace("▲", "▼");
+      }
+      tab_header.innerHTML = new_text;
+    });
+  }
+});

WebHostLib/static/assets/tutorial/archipelago/advanced_settings_en.md

@@ -76,7 +76,7 @@ that can be rolled by these settings. If a game can be rolled it **must** have a
 
 Some options in Archipelago can be used by every game but must still be placed within the relevant game's section.
 Currently, these options are `start_inventory`, `start_hints`, `local_items`, `non_local_items`, `start_location_hints`, 
-`exclude_locations`, and various [plando options](tutorial/archipelago/plando/en).
+`exclude_locations`, and various [plando options](/tutorial/archipelago/plando/en).
 * `start_inventory` will give any items defined here to you at the beginning of your game. The format for this must be
 the name as it appears in the game files and the amount you would like to start with. For example `Rupees(5): 6` which
 will give you 30 rupees.

WebHostLib/static/styles/supermetroidTracker.css

@@ -0,0 +1,104 @@
+#player-tracker-wrapper{
+    margin: 0;
+}
+
+#inventory-table{
+    border-top: 2px solid #000000;
+    border-left: 2px solid #000000;
+    border-right: 2px solid #000000;
+    border-top-left-radius: 4px;
+    border-top-right-radius: 4px;
+    padding: 3px 3px 10px;
+    width: 384px;
+    background-color: #546E7A;
+}
+
+#inventory-table td{
+    width: 45px;
+    height: 45px;
+    text-align: center;
+    vertical-align: middle;
+}
+
+#inventory-table img{
+    height: 100%;
+    max-width: 40px;
+    max-height: 40px;
+    min-width: 40px;
+    min-height: 40px;
+    filter: grayscale(100%) contrast(75%) brightness(30%);
+}
+
+#inventory-table img.acquired{
+    filter: none;
+}
+
+#inventory-table div.counted-item {
+    position: relative;
+}
+
+#inventory-table div.item-count {
+    position: absolute;
+    color: white;
+    font-family: "Minecraftia", monospace;
+    font-weight: bold;
+    bottom: 0px;
+    right: 0px;
+}
+
+#location-table{
+    width: 384px;
+    border-left: 2px solid #000000;
+    border-right: 2px solid #000000;
+    border-bottom: 2px solid #000000;
+    border-bottom-left-radius: 4px;
+    border-bottom-right-radius: 4px;
+    background-color: #546E7A;
+    color: #000000;
+    padding: 0 3px 3px;
+    font-size: 14px;
+    cursor: default;
+}
+
+#location-table th{
+    vertical-align: middle;
+    text-align: left;
+    padding-right: 10px;
+}
+
+#location-table td{
+    padding-top: 2px;
+    padding-bottom: 2px;
+    line-height: 20px;
+}
+
+#location-table td.counter {
+    text-align: right;
+    font-size: 14px;
+}
+
+#location-table td.toggle-arrow {
+    text-align: right;
+}
+
+#location-table tr#Total-header {
+    font-weight: bold;
+}
+
+#location-table img{
+    height: 100%;
+    max-width: 30px;
+    max-height: 30px;
+}
+
+#location-table tbody.locations {
+    font-size: 12px;
+}
+
+#location-table td.location-name {
+    padding-left: 16px;
+}
+
+.hide {
+    display: none;
+}

WebHostLib/templates/supermetroidTracker.html

@@ -0,0 +1,85 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+    <title>{{ player_name }}&apos;s Tracker</title>
+    <link rel="stylesheet" type="text/css" href="{{ url_for('static', filename='styles/supermetroidTracker.css') }}"/>
+    <script type="application/ecmascript" src="{{ url_for('static', filename='assets/supermetroidTracker.js') }}"></script>
+</head>
+
+<body>
+    <div id="player-tracker-wrapper" data-tracker="{{ room.tracker|suuid }}">
+        <table id="inventory-table">
+            <tr>
+                <td><img src="{{ icons['Charge Beam'] }}" class="{{ 'acquired' if 'Charge Beam' in acquired_items }}" title="Charge Beam" /></td>
+                <td><img src="{{ icons['Ice Beam'] }}" class="{{ 'acquired' if 'Ice Beam' in acquired_items }}" title="Ice Beam" /></td>
+                <td><img src="{{ icons['Wave Beam'] }}" class="{{ 'acquired' if 'Wave Beam' in acquired_items }}" title="Wave Beam" /></td>
+                <td><img src="{{ icons['Spazer'] }}" class="{{ 'acquired' if 'Spazer' in acquired_items }}" title="S p a z e r" /></td>
+                <td><img src="{{ icons['Plasma Beam'] }}" class="{{ 'acquired' if 'Plasma Beam' in acquired_items }}" title="Plasma Beam" /></td>
+                <td><img src="{{ icons['Varia Suit'] }}" class="{{ 'acquired' if 'Varia Suit' in acquired_items }}" title="Varia Suit" /></td>
+                <td><img src="{{ icons['Gravity Suit'] }}" class="{{ 'acquired' if 'Gravity Suit' in acquired_items }}" title="Gravity Suit" /></td>
+            </tr>
+            <tr>
+               <td><img src="{{ icons['Morph Ball'] }}" class="{{ 'acquired' if 'Morph Ball' in acquired_items }}" title="Morph Ball" /></td>
+                <td><img src="{{ icons['Bomb'] }}" class="{{ 'acquired' if 'Bomb' in acquired_items }}" title="Bomb" /></td>
+                <td><img src="{{ icons['Spring Ball'] }}" class="{{ 'acquired' if 'Spring Ball' in acquired_items }}" title="Spring Ball" /></td>
+                <td><img src="{{ icons['Screw Attack'] }}" class="{{ 'acquired' if 'Screw Attack' in acquired_items }}" title="Screw Attack" /></td>
+                <td><img src="{{ icons['Hi-Jump Boots'] }}" class="{{ 'acquired' if 'Hi-Jump Boots' in acquired_items }}" title="Hi-Jump Boots" /></td>
+                <td><img src="{{ icons['Space Jump'] }}" class="{{ 'acquired' if 'Space Jump' in acquired_items }}" title="Space Jump" /></td>
+                <td><img src="{{ icons['Speed Booster'] }}" class="{{ 'acquired' if 'Speed Booster' in acquired_items }}" title="Speed Booster" /></td>
+
+
+            </tr>
+            <tr>
+                <td>
+                    <div class="counted-item">
+                        <img src="{{ icons['Energy Tank'] }}" class="{{ 'acquired' if energy_count > 0 }}" title="Energy Tank" />
+                        <div class="item-count">{{ energy_count }}</div>
+                    </div>
+                </td>
+                <td>
+                    <div class="counted-item">
+                        <img src="{{ icons['Reserve Tank'] }}" class="{{ 'acquired' if reserve_count > 0 }}" title="Reserve Tank" />
+                        <div class="item-count">{{ reserve_count }}</div>
+                    </div>
+                </td>
+                <td>
+                    <div class="counted-item">
+                        <img src="{{ icons['Missile'] }}" class="{{ 'acquired' if missile_count > 0 }}" title="Missile ({{missile_count * 5}})" />
+                        <div class="item-count">{{ missile_count }}</div>
+                    </div>
+                </td>
+                <td>
+                    <div class="counted-item">
+                        <img src="{{ icons['Super Missile'] }}" class="{{ 'acquired' if super_count > 0 }}" title="Super Missile ({{super_count * 5}})" />
+                        <div class="item-count">{{ super_count }}</div>
+                    </div>
+                </td>
+                <td>
+                    <div class="counted-item">
+                        <img src="{{ icons['Power Bomb'] }}" class="{{ 'acquired' if power_count > 0 }}" title="Power Bomb ({{power_count * 5}})" />
+                        <div class="item-count">{{ power_count }}</div>
+                    </div>
+                </td>
+                <td><img src="{{ icons['Grappling Beam'] }}" class="{{ 'acquired' if 'Grappling Beam' in acquired_items }}" title="Grappling Beam" /></td>
+                <td><img src="{{ icons['X-Ray Scope'] }}" class="{{ 'acquired' if 'X-Ray Scope' in acquired_items }}" title="X-Ray Scope" /></td>
+            </tr>
+        </table>
+        <table id="location-table">
+            {% for area in checks_done %}
+            <tr class="location-category" id="{{area}}-header">
+                <td>{{ area }} {{'▼' if area != 'Total'}}</td>
+                <td class="counter">{{ checks_done[area] }} / {{ checks_in_area[area] }}</td>
+            </tr>
+            <tbody class="locations hide" id="{{area}}">
+                {% for location in location_info[area] %}
+                <tr>
+                    <td class="location-name">{{ location }}</td>
+                    <td class="counter">{{ '✔' if location_info[area][location] else '' }}</td>
+                </tr>
+                {% endfor %}
+            </tbody>
+            {% endfor %}
+        </table>
+    </div>
+</body>
+</html>

WebHostLib/tracker.py

@@ -774,6 +774,106 @@ def __renderTimespinnerTracker(multisave: Dict[str, Any], room: Room, locations:
                             checks_done=checks_done, checks_in_area=checks_in_area, location_info=location_info,
                             **display_data)
 
+def __renderSuperMetroidTracker(multisave: Dict[str, Any], room: Room, locations: Dict[int, Dict[int, Tuple[int, int]]],
+                                inventory: Counter, team: int, player: int, playerName: str,
+                                seed_checks_in_area: Dict[int, Dict[str, int]], checks_done: Dict[str, int]) -> str:
+
+    icons = {
+        "Energy Tank":      "https://randommetroidsolver.pythonanywhere.com/solver/static/images/ETank.png",
+        "Missile":          "https://randommetroidsolver.pythonanywhere.com/solver/static/images/Missile.png",
+        "Super Missile":    "https://randommetroidsolver.pythonanywhere.com/solver/static/images/Super.png",
+        "Power Bomb":       "https://randommetroidsolver.pythonanywhere.com/solver/static/images/PowerBomb.png",
+        "Bomb":             "https://randommetroidsolver.pythonanywhere.com/solver/static/images/Bomb.png",
+        "Charge Beam":      "https://randommetroidsolver.pythonanywhere.com/solver/static/images/Charge.png",
+        "Ice Beam":         "https://randommetroidsolver.pythonanywhere.com/solver/static/images/Ice.png",
+        "Hi-Jump Boots":    "https://randommetroidsolver.pythonanywhere.com/solver/static/images/HiJump.png",
+        "Speed Booster":    "https://randommetroidsolver.pythonanywhere.com/solver/static/images/SpeedBooster.png",
+        "Wave Beam":        "https://randommetroidsolver.pythonanywhere.com/solver/static/images/Wave.png",
+        "Spazer":           "https://randommetroidsolver.pythonanywhere.com/solver/static/images/Spazer.png",
+        "Spring Ball":      "https://randommetroidsolver.pythonanywhere.com/solver/static/images/SpringBall.png",
+        "Varia Suit":       "https://randommetroidsolver.pythonanywhere.com/solver/static/images/Varia.png",
+        "Plasma Beam":      "https://randommetroidsolver.pythonanywhere.com/solver/static/images/Plasma.png",
+        "Grappling Beam":   "https://randommetroidsolver.pythonanywhere.com/solver/static/images/Grapple.png",
+        "Morph Ball":       "https://randommetroidsolver.pythonanywhere.com/solver/static/images/Morph.png",
+        "Reserve Tank":     "https://randommetroidsolver.pythonanywhere.com/solver/static/images/Reserve.png",
+        "Gravity Suit":     "https://randommetroidsolver.pythonanywhere.com/solver/static/images/Gravity.png",
+        "X-Ray Scope":      "https://randommetroidsolver.pythonanywhere.com/solver/static/images/XRayScope.png",
+        "Space Jump":       "https://randommetroidsolver.pythonanywhere.com/solver/static/images/SpaceJump.png",
+        "Screw Attack":     "https://randommetroidsolver.pythonanywhere.com/solver/static/images/ScrewAttack.png",
+        "Nothing":          "",
+        "No Energy":        "",
+        "Kraid":            "",
+        "Phantoon":         "",
+        "Draygon":          "",
+        "Ridley":           "",
+        "Mother Brain":     "",
+    }
+
+    multi_items = {
+        "Energy Tank": 83000,
+        "Missile": 83001,
+        "Super Missile": 83002,
+        "Power Bomb": 83003,
+        "Reserve Tank": 83020,
+    }
+
+    supermetroid_location_ids = {
+        'Crateria/Blue Brinstar': [82005, 82007, 82008, 82026, 82029,
+                     82000, 82004, 82006, 82009, 82010,
+                     82011, 82012, 82027, 82028, 82034,
+                     82036, 82037],
+        'Green/Pink Brinstar': [82017, 82023, 82030, 82033, 82035,
+                              82013, 82014, 82015, 82016, 82018,
+                              82019, 82021, 82022, 82024, 82025,
+                              82031],
+        'Red Brinstar': [82038, 82042, 82039, 82040, 82041],
+        'Kraid': [82043, 82048, 82044],
+        'Norfair': [82050, 82053, 82061, 82066, 82068,
+                    82049, 82051, 82054, 82055, 82056,
+                    82062, 82063, 82064, 82065, 82067],
+        'Lower Norfair': [82078, 82079, 82080, 82070, 82071,
+                         82073, 82074, 82075, 82076, 82077],
+        'Crocomire': [82052, 82060, 82057, 82058, 82059],
+        'Wrecked Ship': [82129, 82132, 82134, 82135, 82001,
+                        82002, 82003, 82128, 82130, 82131,
+                        82133],
+        'West Maridia': [82138, 82136, 82137, 82139, 82140,
+                        82141, 82142],
+        'East Maridia': [82143, 82145, 82150, 82152, 82154,
+                        82144, 82146, 82147, 82148, 82149,
+                        82151],
+    }
+
+    display_data = {}
+
+
+    for item_name, item_id in multi_items.items():
+        base_name = item_name.split()[0].lower()
+        count = inventory[item_id]
+        display_data[base_name+"_count"] = inventory[item_id]
+
+    # Victory condition
+    game_state = multisave.get("client_game_state", {}).get((team, player), 0)
+    display_data['game_finished'] = game_state == 30
+
+    # Turn location IDs into advancement tab counts
+    checked_locations = multisave.get("location_checks", {}).get((team, player), set())
+    lookup_name = lambda id: lookup_any_location_id_to_name[id]
+    location_info = {tab_name: {lookup_name(id): (id in checked_locations) for id in tab_locations}
+                     for tab_name, tab_locations in supermetroid_location_ids.items()}
+    checks_done = {tab_name: len([id for id in tab_locations if id in checked_locations])
+                   for tab_name, tab_locations in supermetroid_location_ids.items()}
+    checks_done['Total'] = len(checked_locations)
+    checks_in_area = {tab_name: len(tab_locations) for tab_name, tab_locations in supermetroid_location_ids.items()}
+    checks_in_area['Total'] = sum(checks_in_area.values())
+
+    return render_template("supermetroidTracker.html",
+                            inventory=inventory, icons=icons,
+                            acquired_items={lookup_any_item_id_to_name[id] for id in inventory if
+                                            id in lookup_any_item_id_to_name},
+                            player=player, team=team, room=room, player_name=playerName,
+                            checks_done=checks_done, checks_in_area=checks_in_area, location_info=location_info,
+                            **display_data)
 
 def __renderGenericTracker(multisave: Dict[str, Any], room: Room, locations: Dict[int, Dict[int, Tuple[int, int]]],
                            inventory: Counter, team: int, player: int, playerName: str,
@@ -887,5 +987,6 @@ game_specific_trackers: typing.Dict[str, typing.Callable] = {
     "Minecraft": __renderMinecraftTracker,
     "Ocarina of Time": __renderOoTTracker,
     "Timespinner": __renderTimespinnerTracker,
-    "A Link to the Past": __renderAlttpTracker
+    "A Link to the Past": __renderAlttpTracker,
+    "Super Metroid": __renderSuperMetroidTracker
 }

kvui.py

@@ -8,11 +8,16 @@ os.environ["KIVY_NO_FILELOG"] = "1"
 os.environ["KIVY_NO_ARGS"] = "1"
 os.environ["KIVY_LOG_ENABLE"] = "0"
 
+from kivy.base import Config
+Config.set("input", "mouse", "mouse,disable_multitouch")
+Config.set('kivy', 'exit_on_escape', '0')
+Config.set('graphics', 'multisamples', '0')  # multisamples crash old intel drivers
+
 from kivy.app import App
 from kivy.core.window import Window
 from kivy.core.clipboard import Clipboard
 from kivy.core.text.markup import MarkupLabel
-from kivy.base import ExceptionHandler, ExceptionManager, Config, Clock
+from kivy.base import ExceptionHandler, ExceptionManager, Clock
 from kivy.factory import Factory
 from kivy.properties import BooleanProperty, ObjectProperty
 from kivy.uix.button import Button
@@ -431,6 +436,4 @@ class KivyJSONtoTextParser(JSONtoTextParser):
 
 ExceptionManager.add_handler(E())
 
-Config.set("input", "mouse", "mouse,disable_multitouch")
-Config.set('kivy', 'exit_on_escape', '0')
 Builder.load_file(Utils.local_path("data", "client.kv"))

requirements.txt

@@ -2,6 +2,6 @@ colorama>=0.4.4
 websockets>=10.1
 PyYAML>=6.0
 fuzzywuzzy>=0.18.0
-appdirs>=1.4.4
 jinja2>=3.0.3
 schema>=0.7.4
+kivy>=2.0.0

setup.py

@@ -141,7 +141,7 @@ for folder in sdl2.dep_bins + glew.dep_bins:
     shutil.copytree(folder, libfolder, dirs_exist_ok=True)
     print('copying', folder, '->', libfolder)
 
-extra_data = ["LICENSE", "data", "EnemizerCLI", "host.yaml", "SNI", "meta.yaml"]
+extra_data = ["LICENSE", "data", "EnemizerCLI", "host.yaml", "SNI"]
 
 for data in extra_data:
     installfile(Path(data))
@@ -155,6 +155,7 @@ for worldname, worldtype in AutoWorldRegister.world_types.items():
         file_name = worldname+".yaml"
         shutil.copyfile(os.path.join("WebHostLib", "static", "generated", "configs", file_name),
                         buildfolder / "Players" / "Templates" / file_name)
+shutil.copyfile("meta.yaml", buildfolder / "Players" / "Templates" / "meta.yaml")
 
 try:
     from maseya import z3pr

worlds/alttp/Rom.py

@@ -2287,7 +2287,7 @@ def write_strings(rom, world, player):
             if hint_count:
                 locations = world.find_items_in_locations(set(items_to_hint), player)
                 local_random.shuffle(locations)
-                for x in range(hint_count):
+                for x in range(min(hint_count, len(locations))):
                     this_location = locations.pop()
                     this_hint = this_location.item.hint_text + ' can be found ' + hint_text(this_location) + '.'
                     tt[hint_locations.pop(0)] = this_hint

worlds/factorio/Options.py

@@ -94,6 +94,8 @@ class TechTreeLayout(Choice):
     option_small_funnels = 7
     option_medium_funnels = 8
     option_large_funnels = 9
+    option_trees = 10
+    option_choices = 11
     default = 0
 
 

worlds/factorio/Shapes.py

@@ -1,4 +1,5 @@
 from typing import Dict, List, Set
+from collections import deque
 
 from worlds.factorio.Options import TechTreeLayout
 
@@ -21,7 +22,9 @@ def get_shapes(factorio_world) -> Dict[str, List[str]]:
     tech_names.sort()
     world.random.shuffle(tech_names)
 
-    if layout == TechTreeLayout.option_small_diamonds:
+    if layout == TechTreeLayout.option_single:
+        pass
+    elif layout == TechTreeLayout.option_small_diamonds:
         slice_size = 4
         while len(tech_names) > slice_size:
             slice = tech_names[:slice_size]
@@ -189,6 +192,55 @@ def get_shapes(factorio_world) -> Dict[str, List[str]]:
                         prerequisites.setdefault(tech_name, set()).update(previous_slice[i:i+2])
                 previous_slice = slice
                 layer_size -= 1
+    elif layout == TechTreeLayout.option_trees:
+        #              0              |
+        #            1   2            |
+        #              3              |
+        #        4   5   6   7        |
+        #              8              |
+        #  9   10   11   12   13  14  |
+        #              15             |
+        #              16             |
+        slice_size = 17
+        while len(tech_names) > slice_size:
+            slice = tech_names[:slice_size]
+            tech_names = tech_names[slice_size:]
+            slice.sort(key=lambda tech_name: len(custom_technologies[tech_name].get_prior_technologies()))
+
+            prerequisites[slice[1]] = {slice[0]}
+            prerequisites[slice[2]] = {slice[0]}
+
+            prerequisites[slice[3]] = {slice[1], slice[2]}
+
+            prerequisites[slice[4]] = {slice[3]}
+            prerequisites[slice[5]] = {slice[3]}
+            prerequisites[slice[6]] = {slice[3]}
+            prerequisites[slice[7]] = {slice[3]}
+
+            prerequisites[slice[8]] = {slice[4], slice[5], slice[6], slice[7]}
+
+            prerequisites[slice[9]] = {slice[8]}
+            prerequisites[slice[10]] = {slice[8]}
+            prerequisites[slice[11]] = {slice[8]}
+            prerequisites[slice[12]] = {slice[8]}
+            prerequisites[slice[13]] = {slice[8]}
+            prerequisites[slice[14]] = {slice[8]}
+
+            prerequisites[slice[15]] = {slice[9], slice[10], slice[11], slice[12], slice[13], slice[14]}
+            prerequisites[slice[16]] = {slice[15]}
+    elif layout == TechTreeLayout.option_choices:
+        tech_names.sort(key=lambda tech_name: len(custom_technologies[tech_name].get_prior_technologies()))
+        current_choices = deque([tech_names[0]])
+        tech_names = tech_names[1:]
+        while len(tech_names) > 1:
+            source = current_choices.pop()
+            choices = tech_names[:2]
+            tech_names = tech_names[2:]
+            for choice in choices:
+                prerequisites[choice] = {source}
+            current_choices.extendleft(choices)
+    else:
+        raise NotImplementedError(f"Layout {layout} is not implemented.")
 
     world.tech_tree_layout_prerequisites[player] = prerequisites
     return prerequisites

worlds/factorio/requirements.txt

@@ -1,3 +1,2 @@
-kivy>=2.0.0
 factorio-rcon-py>=1.2.1
 schema>=0.7.4

worlds/oot/Rom.py

@@ -282,22 +282,22 @@ class Rom(BigStream):
 
 
 def compress_rom_file(input_file, output_file):
-    subcall = []
-
     compressor_path = data_path("Compress")
 
     if platform.system() == 'Windows':
-        compressor_path += "\\Compress.exe"
+        executable_path = "Compress.exe"
     elif platform.system() == 'Linux':
         if platform.uname()[4] == 'aarch64' or platform.uname()[4] == 'arm64':
-            compressor_path += "/Compress_ARM64"
+            executable_path = "Compress_ARM64"
         else:
-            compressor_path += "/Compress"
+            executable_path = "Compress"
     elif platform.system() == 'Darwin':
-        compressor_path += "/Compress.out"
+        executable_path = "Compress.out"
     else:
         raise RuntimeError('Unsupported operating system for compression.')
-
+    compressor_path = os.path.join(compressor_path, executable_path)
     if not os.path.exists(compressor_path):
         raise RuntimeError(f'Compressor does not exist! Please place it at {compressor_path}.')
-    process = subprocess.call([compressor_path, input_file, output_file], **subprocess_args(include_stdout=False))
+    import logging
+    logging.info(subprocess.check_output([compressor_path, input_file, output_file],
+                                             **subprocess_args(include_stdout=False)))

worlds/sm/Options.py

@@ -42,7 +42,7 @@ class StartLocation(Choice):
 
 class DeathLink(Choice):
     """When DeathLink is enabled and someone dies, you will die. With survive reserve tanks can save you."""
-    displayname = "Death Link Survive"
+    displayname = "Death Link"
     option_disable = 0
     option_enable = 1
     option_enable_survive = 3

worlds/sm/variaRandomizer/randomizer.py

@@ -348,8 +348,7 @@ class VariaRandomizer:
                 if response.ok:
                     PresetLoader.factory(json.loads(response.text)).load(self.player)
                 else:
-                    print("Got error {} {} {} from trying to fetch varia custom preset named {}".format(response.status_code, response.reason, response.text, preset_name))
+                    raise Exception("Got error {} {} {} from trying to fetch varia custom preset named {}".format(response.status_code, response.reason, response.text, preset_name))
-                    sys.exit(-1)
             else:
                 preset = 'default'
                 PresetLoader.factory(os.path.join(appDir, getPresetDir('casual'), 'casual.json')).load(self.player)
@@ -365,13 +364,11 @@ class VariaRandomizer:
             self.seed = args.seed
         logger.debug("seed: {}".format(self.seed))
 
-        seed4rand = self.seed
         if args.raceMagic is not None:
             if args.raceMagic <= 0 or args.raceMagic >= 0x10000:
                 print("Invalid magic")
                 sys.exit(-1)
-            seed4rand = self.seed ^ args.raceMagic
+
-        # random.seed(seed4rand)
         # if no max diff, set it very high
         if args.maxDifficulty:
             if args.maxDifficulty == 'random':

worlds/soe/Options.py

@@ -16,10 +16,11 @@ class EvermizerFlag:
         return self.flag if self.value != self.default else ''
 
 
-class OffOnChaosChoice(Choice):
+class OffOnFullChoice(Choice):
     option_off = 0
     option_on = 1
-    option_chaos = 2
+    option_full = 2
+    alias_chaos = 2
     alias_false = 0
     alias_true = 1
 
@@ -30,7 +31,8 @@ class Difficulty(EvermizerFlags, Choice):
     option_easy = 0
     option_normal = 1
     option_hard = 2
-    option_chaos = 3  # random is reserved pre 0.2
+    option_mystery = 3  # 'random' is reserved
+    alias_chaos = 3
     default = 1
     flags = ['e', 'n', 'h', 'x']
 
@@ -88,27 +90,27 @@ class ShorterDialogs(EvermizerFlag, Toggle):
 
 
 class ShortBossRush(EvermizerFlag, Toggle):
-    """Start boss rush at Magmar, cut HP in half"""
+    """Start boss rush at Metal Magmar, cut enemy HP in half"""
     displayname = "Short Boss Rush"
     flag = 'f'
 
 
-class Ingredienizer(EvermizerFlags, OffOnChaosChoice):
+class Ingredienizer(EvermizerFlags, OffOnFullChoice):
-    """Shuffles or randomizes spell ingredients"""
+    """On Shuffles, Full randomizes spell ingredients"""
     displayname = "Ingredienizer"
     default = 1
     flags = ['i', '', 'I']
 
 
-class Sniffamizer(EvermizerFlags, OffOnChaosChoice):
+class Sniffamizer(EvermizerFlags, OffOnFullChoice):
-    """Shuffles or randomizes drops in sniff locations"""
+    """On Shuffles, Full randomizes drops in sniff locations"""
     displayname = "Sniffamizer"
     default = 1
     flags = ['s', '', 'S']
 
 
-class Callbeadamizer(EvermizerFlags, OffOnChaosChoice):
+class Callbeadamizer(EvermizerFlags, OffOnFullChoice):
-    """Shuffles call bead characters or spells"""
+    """On Shuffles call bead characters, Full shuffles individual spells"""
     displayname = "Callbeadamizer"
     default = 1
     flags = ['c', '', 'C']
@@ -120,8 +122,8 @@ class Musicmizer(EvermizerFlag, Toggle):
     flag = 'm'
 
 
-class Doggomizer(EvermizerFlags, OffOnChaosChoice):
+class Doggomizer(EvermizerFlags, OffOnFullChoice):
-    """On shuffles dog per act, Chaos randomizes dog per screen, Pupdunk gives you Everpupper everywhere"""
+    """On shuffles dog per act, Full randomizes dog per screen, Pupdunk gives you Everpupper everywhere"""
     displayname = "Doggomizer"
     option_pupdunk = 3
     default = 0

worlds/soe/requirements.txt

@@ -1,14 +1,14 @@
-https://github.com/black-sliver/pyevermizer/releases/download/v0.39.2/pyevermizer-0.39.2-cp38-cp38-win_amd64.whl#egg=pyevermizer; sys_platform == 'win32' and platform_machine == 'AMD64' and python_version == '3.8'
+https://github.com/black-sliver/pyevermizer/releases/download/v0.40.0/pyevermizer-0.40.0-cp38-cp38-win_amd64.whl#egg=pyevermizer; sys_platform == 'win32' and platform_machine == 'AMD64' and python_version == '3.8'
-https://github.com/black-sliver/pyevermizer/releases/download/v0.39.2/pyevermizer-0.39.2-cp39-cp39-win_amd64.whl#egg=pyevermizer; sys_platform == 'win32' and platform_machine == 'AMD64' and python_version == '3.9'
+https://github.com/black-sliver/pyevermizer/releases/download/v0.40.0/pyevermizer-0.40.0-cp39-cp39-win_amd64.whl#egg=pyevermizer; sys_platform == 'win32' and platform_machine == 'AMD64' and python_version == '3.9'
-https://github.com/black-sliver/pyevermizer/releases/download/v0.39.2/pyevermizer-0.39.2-cp310-cp310-win_amd64.whl#egg=pyevermizer; sys_platform == 'win32' and platform_machine == 'AMD64' and python_version == '3.10'
+https://github.com/black-sliver/pyevermizer/releases/download/v0.40.0/pyevermizer-0.40.0-cp310-cp310-win_amd64.whl#egg=pyevermizer; sys_platform == 'win32' and platform_machine == 'AMD64' and python_version == '3.10'
-https://github.com/black-sliver/pyevermizer/releases/download/v0.39.2/pyevermizer-0.39.2-cp38-cp38-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_12_x86_64.manylinux2010_x86_64.whl#egg=pyevermizer; sys_platform == 'linux' and platform_machine == 'x86_64' and python_version == '3.8'
+https://github.com/black-sliver/pyevermizer/releases/download/v0.40.0/pyevermizer-0.40.0-cp38-cp38-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_12_x86_64.manylinux2010_x86_64.whl#egg=pyevermizer; sys_platform == 'linux' and platform_machine == 'x86_64' and python_version == '3.8'
-https://github.com/black-sliver/pyevermizer/releases/download/v0.39.2/pyevermizer-0.39.2-cp39-cp39-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_12_x86_64.manylinux2010_x86_64.whl#egg=pyevermizer; sys_platform == 'linux' and platform_machine == 'x86_64' and python_version == '3.9'
+https://github.com/black-sliver/pyevermizer/releases/download/v0.40.0/pyevermizer-0.40.0-cp39-cp39-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_12_x86_64.manylinux2010_x86_64.whl#egg=pyevermizer; sys_platform == 'linux' and platform_machine == 'x86_64' and python_version == '3.9'
-https://github.com/black-sliver/pyevermizer/releases/download/v0.39.2/pyevermizer-0.39.2-cp310-cp310-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_12_x86_64.manylinux2010_x86_64.whl#egg=pyevermizer; sys_platform == 'linux' and platform_machine == 'x86_64' and python_version == '3.10'
+https://github.com/black-sliver/pyevermizer/releases/download/v0.40.0/pyevermizer-0.40.0-cp310-cp310-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_12_x86_64.manylinux2010_x86_64.whl#egg=pyevermizer; sys_platform == 'linux' and platform_machine == 'x86_64' and python_version == '3.10'
-https://github.com/black-sliver/pyevermizer/releases/download/v0.39.2/pyevermizer-0.39.2-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl#egg=pyevermizer; sys_platform == 'linux' and platform_machine == 'aarch64' and python_version == '3.8'
+https://github.com/black-sliver/pyevermizer/releases/download/v0.40.0/pyevermizer-0.40.0-cp38-cp38-manylinux_2_17_aarch64.manylinux2014_aarch64.whl#egg=pyevermizer; sys_platform == 'linux' and platform_machine == 'aarch64' and python_version == '3.8'
-https://github.com/black-sliver/pyevermizer/releases/download/v0.39.2/pyevermizer-0.39.2-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl#egg=pyevermizer; sys_platform == 'linux' and platform_machine == 'aarch64' and python_version == '3.9'
+https://github.com/black-sliver/pyevermizer/releases/download/v0.40.0/pyevermizer-0.40.0-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl#egg=pyevermizer; sys_platform == 'linux' and platform_machine == 'aarch64' and python_version == '3.9'
-https://github.com/black-sliver/pyevermizer/releases/download/v0.39.2/pyevermizer-0.39.2-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl#egg=pyevermizer; sys_platform == 'linux' and platform_machine == 'aarch64' and python_version == '3.10'
+https://github.com/black-sliver/pyevermizer/releases/download/v0.40.0/pyevermizer-0.40.0-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl#egg=pyevermizer; sys_platform == 'linux' and platform_machine == 'aarch64' and python_version == '3.10'
-https://github.com/black-sliver/pyevermizer/releases/download/v0.39.2/pyevermizer-0.39.2-cp38-cp38-macosx_10_9_amd64.whl#egg=pyevermizer; sys_platform == 'darwin' and python_version == '3.8'
+https://github.com/black-sliver/pyevermizer/releases/download/v0.40.0/pyevermizer-0.40.0-cp38-cp38-macosx_10_9_x86_64.whl#egg=pyevermizer; sys_platform == 'darwin' and python_version == '3.8'
-#https://github.com/black-sliver/pyevermizer/releases/download/v0.39.2/pyevermizer-0.39.2-cp39-cp39-macosx_10_9_amd64.whl#egg=pyevermizer; sys_platform == 'darwin' and python_version == '3.9'
+#https://github.com/black-sliver/pyevermizer/releases/download/v0.40.0/pyevermizer-0.40.0-cp39-cp39-macosx_10_9_x86_64.whl#egg=pyevermizer; sys_platform == 'darwin' and python_version == '3.9'
-https://github.com/black-sliver/pyevermizer/releases/download/v0.39.2/pyevermizer-0.39.2-cp39-cp39-macosx_10_9_universal2.whl#egg=pyevermizer; sys_platform == 'darwin' and python_version == '3.9'
+https://github.com/black-sliver/pyevermizer/releases/download/v0.40.0/pyevermizer-0.40.0-cp39-cp39-macosx_10_9_universal2.whl#egg=pyevermizer; sys_platform == 'darwin' and python_version == '3.9'
-https://github.com/black-sliver/pyevermizer/releases/download/v0.39.2/pyevermizer-0.39.2-cp310-cp310-macosx_10_9_universal2.whl#egg=pyevermizer; sys_platform == 'darwin' and python_version == '3.10'
+https://github.com/black-sliver/pyevermizer/releases/download/v0.40.0/pyevermizer-0.40.0-cp310-cp310-macosx_10_9_universal2.whl#egg=pyevermizer; sys_platform == 'darwin' and python_version == '3.10'
 bsdiff4>=1.2.1

worlds/timespinner/Items.py

@@ -213,6 +213,7 @@ starter_melee_weapons: Tuple[str, ...] = (
 )
 
 starter_spells: Tuple[str, ...] = (
+    'Aura Blast',
     'Colossal Blade',
     'Infernal Flames',
     'Plasma Geyser',

worlds/timespinner/Options.py

@@ -50,6 +50,10 @@ class Cantoran(Toggle):
     "Cantoran's fight and check are available upon revisiting his room"
     display_name = "Cantoran"
 
+class DamageRando(Toggle):
+    "Each orb has a high chance of having lower base damage and a low chance of having much higher base damage."
+    display_name = "Damage Rando"
+
 # Some options that are available in the timespinner randomizer arent currently implemented
 timespinner_options: Dict[str, Toggle] = {
     "StartWithJewelryBox": StartWithJewelryBox,
@@ -64,6 +68,7 @@ timespinner_options: Dict[str, Toggle] = {
     #"StinkyMaw": StinkyMaw,
     "GyreArchives": GyreArchives,
     "Cantoran": Cantoran,
+    "DamageRando": DamageRando,
     "DeathLink": DeathLink,
 }
 

worlds/timespinner/PyramidKeys.py

@@ -27,4 +27,7 @@ def get_pyramid_keys_unlock(world: MultiWorld, player: int) -> str:
     else:
         gates = (*past_teleportation_gates, *present_teleportation_gates)
 
+    if not world:
+        return gates[0]
+
     return world.random.choice(gates)

worlds/timespinner/Regions.py

@@ -1,4 +1,4 @@
-from typing import List, Dict, Tuple, Optional, Callable
+from typing import List, Set, Dict, Tuple, Optional, Callable
 from BaseClasses import MultiWorld, Region, Entrance, Location, RegionType
 from .Options import is_option_enabled
 from .Locations import LocationData
@@ -6,7 +6,7 @@ from .Locations import LocationData
 def create_regions(world: MultiWorld, player: int, locations: Tuple[LocationData, ...], location_cache: List[Location], pyramid_keys_unlock: str):
     locations_per_region = get_locations_per_region(locations)
 
-    world.regions += [
+    regions = [
         create_region(world, player, locations_per_region, location_cache, 'Menu'),
         create_region(world, player, locations_per_region, location_cache, 'Tutorial'),
         create_region(world, player, locations_per_region, location_cache, 'Lake desolation'),
@@ -45,6 +45,11 @@ def create_regions(world: MultiWorld, player: int, locations: Tuple[LocationData
         create_region(world, player, locations_per_region, location_cache, 'Space time continuum')
     ]
 
+    if __debug__:
+        throwIfAnyLocationIsNotAssignedToARegion(regions, locations_per_region.keys())
+
+    world.regions += regions
+
     connectStartingRegion(world, player)
 
     names: Dict[str, int] = {}
@@ -94,8 +99,8 @@ def create_regions(world: MultiWorld, player: int, locations: Tuple[LocationData
     connect(world, player, names, 'Skeleton Shaft', 'Sealed Caves (upper)', lambda state: state._timespinner_has_keycard_A(world, player))
     connect(world, player, names, 'Skeleton Shaft', 'Space time continuum', lambda state: state.has('Twin Pyramid Key', player))
     connect(world, player, names, 'Sealed Caves (upper)', 'Skeleton Shaft')
-    connect(world, player, names, 'Sealed Caves (upper)', 'Sealed Caves (Xarion)', lambda state: state.has('Twin Pyramid Key', player) or state._timespinner_has_forwarddash_doublejump(world, player))
+    connect(world, player, names, 'Sealed Caves (upper)', 'Sealed Caves (Xarion)', lambda state: state.has('Twin Pyramid Key', player) or state._timespinner_has_doublejump(world, player))
-    connect(world, player, names, 'Sealed Caves (Xarion)', 'Sealed Caves (upper)', lambda state: state._timespinner_has_forwarddash_doublejump(world, player))
+    connect(world, player, names, 'Sealed Caves (Xarion)', 'Sealed Caves (upper)', lambda state: state._timespinner_has_doublejump(world, player))
     connect(world, player, names, 'Sealed Caves (Xarion)', 'Space time continuum', lambda state: state.has('Twin Pyramid Key', player))
     connect(world, player, names, 'Refugee Camp', 'Forest')
     connect(world, player, names, 'Refugee Camp', 'Library', lambda state: not is_option_enabled(world, player, "Inverted"))
@@ -114,9 +119,9 @@ def create_regions(world: MultiWorld, player: int, locations: Tuple[LocationData
     connect(world, player, names, 'Lower Lake Serene', 'Left Side forest Caves')
     connect(world, player, names, 'Lower Lake Serene', 'Caves of Banishment (upper)')
     connect(world, player, names, 'Caves of Banishment (upper)', 'Upper Lake Serene', lambda state: state.has('Water Mask', player))
-    connect(world, player, names, 'Caves of Banishment (upper)', 'Caves of Banishment (Maw)', lambda state: state.has('Twin Pyramid Key', player) or state._timespinner_has_forwarddash_doublejump(world, player))
+    connect(world, player, names, 'Caves of Banishment (upper)', 'Caves of Banishment (Maw)', lambda state: state.has('Twin Pyramid Key', player) or state._timespinner_has_doublejump(world, player))
     connect(world, player, names, 'Caves of Banishment (upper)', 'Space time continuum', lambda state: state.has('Twin Pyramid Key', player))
-    connect(world, player, names, 'Caves of Banishment (Maw)', 'Caves of Banishment (upper)', lambda state: state._timespinner_has_forwarddash_doublejump(world, player))
+    connect(world, player, names, 'Caves of Banishment (Maw)', 'Caves of Banishment (upper)', lambda state: state._timespinner_has_doublejump(world, player))
     connect(world, player, names, 'Caves of Banishment (Maw)', 'Caves of Banishment (Sirens)', lambda state: state.has('Gas Mask', player))
     connect(world, player, names, 'Caves of Banishment (Maw)', 'Space time continuum', lambda state: state.has('Twin Pyramid Key', player))
     connect(world, player, names, 'Caves of Banishment (Sirens)', 'Forest')
@@ -150,6 +155,16 @@ def create_regions(world: MultiWorld, player: int, locations: Tuple[LocationData
     connect(world, player, names, 'Space time continuum', 'Caves of Banishment (upper)', lambda state: pyramid_keys_unlock == "GateCavesOfBanishment")
 
 
+def throwIfAnyLocationIsNotAssignedToARegion(regions: List[Region], regionNames: Set[str]):
+    existingRegions = set()
+
+    for region in regions:
+        existingRegions.add(region.name)
+
+    if (regionNames - existingRegions):
+        raise Exception("Tiemspinner: the following regions are used in locations: {}, but no such region exists".format(regionNames - existingRegions))
+
+
 def create_location(player: int, location_data: LocationData, region: Region, location_cache: List[Location]) -> Location:
     location = Location(player, location_data.name, location_data.code, region)
     location.access_rule = location_data.rule

worlds/timespinner/__init__.py

@@ -1,4 +1,4 @@
-from typing import Dict, List, Set, TextIO
+from typing import Dict, List, Set, Tuple, TextIO
 from BaseClasses import Item, MultiWorld, Location
 from ..AutoWorld import World
 from .LogicMixin import TimespinnerLogic
@@ -24,19 +24,31 @@ class TimespinnerWorld(World):
     location_name_to_id = {location.name: location.code for location in get_locations(None, None)}
     item_name_groups = get_item_names_per_category()
 
-    locked_locations: Dict[int, List[str]] = {}
+    locked_locations: List[str]
-    pyramid_keys_unlock: Dict[int, str] = {}
+    pyramid_keys_unlock: str
-    location_cache: Dict[int, List[Location]] = {}
+    location_cache: List[Location]
+
+    def __init__(self, world: MultiWorld, player: int):
+        super().__init__(world, player)
+
+        self.locked_locations = []
+        self.location_cache = []
+        self.pyramid_keys_unlock = get_pyramid_keys_unlock(world, player)
+
 
     def generate_early(self):
-        self.locked_locations[self.player] = []
+        # in generate_early the start_inventory isnt copied over to precollected_items yet, so we can still modify the options directly
-        self.location_cache[self.player] = []
+        if self.world.start_inventory[self.player].value.pop('Meyef', 0) > 0:
-        self.pyramid_keys_unlock[self.player] = get_pyramid_keys_unlock(self.world, self.player)
+            self.world.StartWithMeyef[self.player].value = self.world.StartWithMeyef[self.player].option_true
+        if self.world.start_inventory[self.player].value.pop('Talaria Attachment', 0) > 0:
+            self.world.QuickSeed[self.player].value = self.world.QuickSeed[self.player].option_true
+        if self.world.start_inventory[self.player].value.pop('Jewelry Box', 0) > 0:
+            self.world.StartWithJewelryBox[self.player].value = self.world.StartWithJewelryBox[self.player].option_true
 
 
     def create_regions(self):
         create_regions(self.world, self.player, get_locations(self.world, self.player), 
-                        self.location_cache[self.player], self.pyramid_keys_unlock[self.player])
+                        self.location_cache, self.pyramid_keys_unlock)
 
 
     def create_item(self, name: str) -> Item:
@@ -44,22 +56,22 @@ class TimespinnerWorld(World):
 
 
     def set_rules(self):
-        setup_events(self.world, self.player, self.locked_locations[self.player], self.location_cache[self.player])
+        setup_events(self.world, self.player, self.locked_locations, self.location_cache)
 
         self.world.completion_condition[self.player] = lambda state: state.has('Killed Nightmare', self.player)
 
 
     def generate_basic(self):
-        excluded_items = get_excluded_items_based_on_options(self.world, self.player)
+        excluded_items = get_excluded_items(self, self.world, self.player)
 
-        assign_starter_items(self.world, self.player, excluded_items, self.locked_locations[self.player])
+        assign_starter_items(self.world, self.player, excluded_items, self.locked_locations)
 
         if not is_option_enabled(self.world, self.player, "QuickSeed") and not is_option_enabled(self.world, self.player, "Inverted"):
-            place_first_progression_item(self.world, self.player, excluded_items, self.locked_locations[self.player])
+            place_first_progression_item(self.world, self.player, excluded_items, self.locked_locations)
 
         pool = get_item_pool(self.world, self.player, excluded_items)
 
-        fill_item_pool_with_dummy_items(self.world, self.player, self.locked_locations[self.player], self.location_cache[self.player], pool)
+        fill_item_pool_with_dummy_items(self.world, self.player, self.locked_locations, self.location_cache, pool)
 
         self.world.itempool += pool
 
@@ -73,17 +85,17 @@ class TimespinnerWorld(World):
         slot_data["StinkyMaw"] = True
         slot_data["ProgressiveVerticalMovement"] = False
         slot_data["ProgressiveKeycards"] = False
-        slot_data["PyramidKeysGate"] = self.pyramid_keys_unlock[self.player]
+        slot_data["PyramidKeysGate"] = self.pyramid_keys_unlock
-        slot_data["PersonalItems"] = get_personal_items(self.player, self.location_cache[self.player])
+        slot_data["PersonalItems"] = get_personal_items(self.player, self.location_cache)
 
         return slot_data
         
 
     def write_spoiler_header(self, spoiler_handle: TextIO):
-        spoiler_handle.write('Twin Pyramid Keys unlock:        %s\n' % (self.pyramid_keys_unlock[self.player]))
+        spoiler_handle.write('Twin Pyramid Keys unlock:        %s\n' % (self.pyramid_keys_unlock))
 
 
-def get_excluded_items_based_on_options(world: MultiWorld, player: int) -> Set[str]:
+def get_excluded_items(self: TimespinnerWorld, world: MultiWorld, player: int) -> Set[str]:
     excluded_items: Set[str] = set()
 
     if is_option_enabled(world, player, "StartWithJewelryBox"):
@@ -93,24 +105,46 @@ def get_excluded_items_based_on_options(world: MultiWorld, player: int) -> Set[s
     if is_option_enabled(world, player, "QuickSeed"):
         excluded_items.add('Talaria Attachment')
 
+    for item in world.precollected_items[player]:
+        if item.name not in self.item_name_groups['UseItem']:
+            excluded_items.add(item.name)
+    
     return excluded_items
 
 
 def assign_starter_items(world: MultiWorld, player: int, excluded_items: Set[str], locked_locations: List[str]):
-    melee_weapon = world.random.choice(starter_melee_weapons)
+    non_local_items = world.non_local_items[player].value
-    spell = world.random.choice(starter_spells)
 
-    excluded_items.add(melee_weapon)
+    local_starter_melee_weapons = tuple(item for item in starter_melee_weapons if item not in non_local_items)
-    excluded_items.add(spell)
+    if not local_starter_melee_weapons:
+        if 'Plasma Orb' in non_local_items:
+            raise Exception("Atleast one melee orb must be local")
+        else:
+            local_starter_melee_weapons = ('Plasma Orb',)
 
-    melee_weapon_item = create_item_with_correct_settings(world, player, melee_weapon)
+    local_starter_spells = tuple(item for item in starter_spells if item not in non_local_items)
-    spell_item = create_item_with_correct_settings(world, player, spell)
+    if not local_starter_spells:
+        if 'Lightwall' in non_local_items:
+            raise Exception("Atleast one spell must be local")
+        else:
+            local_starter_spells = ('Lightwall',)
 
-    world.get_location('Yo Momma 1', player).place_locked_item(melee_weapon_item)
+    assign_starter_item(world, player, excluded_items, locked_locations, 'Yo Momma 1', local_starter_melee_weapons)
-    world.get_location('Yo Momma 2', player).place_locked_item(spell_item)
+    assign_starter_item(world, player, excluded_items, locked_locations, 'Yo Momma 2', local_starter_spells)
 
-    locked_locations.append('Yo Momma 1')
+
-    locked_locations.append('Yo Momma 2')
+def assign_starter_item(world: MultiWorld, player: int, excluded_items: Set[str], locked_locations: List[str], 
+        location: str, item_list: Tuple[str, ...]):
+
+    item_name = world.random.choice(item_list)
+
+    excluded_items.add(item_name)
+
+    item = create_item_with_correct_settings(world, player, item_name)
+
+    world.get_location(location, player).place_locked_item(item)
+
+    locked_locations.append(location)
 
 
 def get_item_pool(world: MultiWorld, player: int, excluded_items: Set[str]) -> List[Item]:
@@ -133,8 +167,20 @@ def fill_item_pool_with_dummy_items(world: MultiWorld, player: int, locked_locat
 
 
 def place_first_progression_item(world: MultiWorld, player: int, excluded_items: Set[str], locked_locations: List[str]):
-    progression_item = world.random.choice(starter_progression_items)
+    for item in world.precollected_items[player]:
-    location = world.random.choice(starter_progression_locations)
+        if item.name in starter_progression_items:
+            return
+    
+    local_starter_progression_items = tuple(
+        item for item in starter_progression_items if item not in world.non_local_items[player].value)
+    non_excluded_starter_progression_locations = tuple(
+        location for location in starter_progression_locations if location not in world.exclude_locations[player].value)
+
+    if  not local_starter_progression_items or not non_excluded_starter_progression_locations:
+        return
+
+    progression_item = world.random.choice(local_starter_progression_items)
+    location = world.random.choice(non_excluded_starter_progression_locations)
 
     excluded_items.add(progression_item)
     locked_locations.append(location)